C12H23N — CID 145471517
N-(2,6-dimethylcyclohexen-1-yl)ethanimine;ethane (PubChem CID 145471517) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexen-1-yl)ethanimine;ethane.
| Compound Name | N-(2,6-dimethylcyclohexen-1-yl)ethanimine;ethane |
|---|---|
| PubChem CID | 145471517 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-(2,6-dimethylcyclohexen-1-yl)ethanimine;ethane |
| SMILES | C/C=N/C1=C(C)CCCC1C.CC |
| InChI | InChI=1S/C10H17N.C2H6/c1-4-11-10-8(2)6-5-7-9(10)3;1-2/h4,8H,5-7H2,1-3H3;1-2H3/b11-4+; |
| InChIKey | PJTLEQVTUYCBLP-SODSUQDMSA-N |
| XLogP | 4.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|