About 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine
2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine (PubChem CID 91035762) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine.
Analyze 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine?
The IUPAC name of 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine (CID 91035762) is 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine.
What is the SMILES notation for 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine?
The canonical SMILES for 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine is CC1CC=NC(=C2CCCCC2)C1.
What is the InChIKey of 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine?
The InChIKey is YXHZWAPJFQQKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h8,10H,2-7,9H2,1H3.
What are the key properties of 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine?
2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine has a molecular weight of 177.29 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylidene-4-methyl-4,5-dihydro-3H-pyridine is sourced from PubChem (CID 91035762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).