C19H21N3 — CID 145472238
2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline (PubChem CID 145472238) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline.
| Compound Name | 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline |
|---|---|
| PubChem CID | 145472238 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline |
| SMILES | C=C1CCc2ccc(CNC(=C)c3ccccc3N)cc2N1 |
| InChI | InChI=1S/C19H21N3/c1-13-7-9-16-10-8-15(11-19(16)22-13)12-21-14(2)17-5-3-4-6-18(17)20/h3-6,8,10-11,21-22H,1-2,7,9,12,20H2 |
| InChIKey | BVYHPSZLQCASJY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|