About 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline
2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline (PubChem CID 145472238) has the molecular formula C19H21N3
and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline.
Molecular Properties
| Compound Name | 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline |
| PubChem CID | 145472238 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline |
| SMILES | C=C1CCc2ccc(CNC(=C)c3ccccc3N)cc2N1 |
| InChI | InChI=1S/C19H21N3/c1-13-7-9-16-10-8-15(11-19(16)22-13)12-21-14(2)17-5-3-4-6-18(17)20/h3-6,8,10-11,21-22H,1-2,7,9,12,20H2 |
| InChIKey | BVYHPSZLQCASJY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline?
The IUPAC name of 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline (CID 145472238) is 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline.
What is the SMILES notation for 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline?
The canonical SMILES for 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline is C=C1CCc2ccc(CNC(=C)c3ccccc3N)cc2N1.
What is the InChIKey of 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline?
The InChIKey is BVYHPSZLQCASJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3/c1-13-7-9-16-10-8-15(11-19(16)22-13)12-21-14(2)17-5-3-4-6-18(17)20/h3-6,8,10-11,21-22H,1-2,7,9,12,20H2.
What are the key properties of 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline?
2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline has a molecular weight of 291.40 g/mol, XLogP of 3.90, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]aniline is sourced from PubChem (CID 145472238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).