C22H32N2O3 — CID 145472824
tert-butyl N-[1-[(5-methyl-3-pyridinyl)oxy]-3-phenylpropan-2-yl]carbamate;ethane (PubChem CID 145472824) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl N-[1-[(5-methyl-3-pyridinyl)oxy]-3-phenylpropan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-[(5-methyl-3-pyridinyl)oxy]-3-phenylpropan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 145472824 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl N-[1-[(5-methyl-3-pyridinyl)oxy]-3-phenylpropan-2-yl]carbamate;ethane |
| SMILES | CC.Cc1cncc(OCC(Cc2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H26N2O3.C2H6/c1-15-10-18(13-21-12-15)24-14-17(11-16-8-6-5-7-9-16)22-19(23)25-20(2,3)4;1-2/h5-10,12-13,17H,11,14H2,1-4H3,(H,22,23);1-2H3 |
| InChIKey | MNEOSQWWHXAKBA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |