C18H30N6O2 — CID 145477254
(E)-2-amino-3-[[4-[(dimethylamino)methyl]phenyl]methylamino]-3-(2-methoxyethoxymethylamino)-N-methylideneprop-2-enimidamide (PubChem CID 145477254) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (E)-2-amino-3-[[4-[(dimethylamino)methyl]phenyl]methylamino]-3-(2-methoxyethoxymethylamino)-N-methylideneprop-2-enimidamide.
| Compound Name | (E)-2-amino-3-[[4-[(dimethylamino)methyl]phenyl]methylamino]-3-(2-methoxyethoxymethylamino)-N-methylideneprop-2-enimidamide |
|---|---|
| PubChem CID | 145477254 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (E)-2-amino-3-[[4-[(dimethylamino)methyl]phenyl]methylamino]-3-(2-methoxyethoxymethylamino)-N-methylideneprop-2-enimidamide |
| SMILES | [H]/N=C(N=C)/C(N)=C(\NCOCCOC)NCc1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C18H30N6O2/c1-21-17(20)16(19)18(23-13-26-10-9-25-4)22-11-14-5-7-15(8-6-14)12-24(2)3/h5-8,20,22-23H,1,9-13,19H2,2-4H3/b18-16+,20-17- |
| InChIKey | KYYRXTSZQJGGEU-MOKUSBMGSA-N |
| XLogP | 0.85 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|