C22H34F3N7O — CID 145477280
(E)-2-amino-N-methylidene-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide (PubChem CID 145477280) has the molecular formula C22H34F3N7O and a molecular weight of 469.56 g/mol. Its IUPAC name is (E)-2-amino-N-methylidene-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide.
| Compound Name | (E)-2-amino-N-methylidene-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 145477280 |
| Molecular Formula | C22H34F3N7O |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (E)-2-amino-N-methylidene-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]-3-(4,4,4-trifluorobutoxymethylamino)prop-2-enimidamide |
| SMILES | [H]/N=C(N=C)/C(N)=C(\NCOCCCC(F)(F)F)NCc1ccc(CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H34F3N7O/c1-28-20(27)19(26)21(30-16-33-13-3-8-22(23,24)25)29-14-17-4-6-18(7-5-17)15-32-11-9-31(2)10-12-32/h4-7,27,29-30H,1,3,8-16,26H2,2H3/b21-19+,27-20- |
| InChIKey | KPMXIHQHYJXWFW-NHGXTTEPSA-N |
| XLogP | 2.24 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|