C24H27N4O2+ — CID 145477986
4-phenylmethoxy-5-piperazin-4-ium-1-yl-2-[3-[(Z)-prop-1-enyl]phenyl]pyridazin-3-one (PubChem CID 145477986) has the molecular formula C24H27N4O2+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-phenylmethoxy-5-piperazin-4-ium-1-yl-2-[3-[(Z)-prop-1-enyl]phenyl]pyridazin-3-one.
| Compound Name | 4-phenylmethoxy-5-piperazin-4-ium-1-yl-2-[3-[(Z)-prop-1-enyl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 145477986 |
| Molecular Formula | C24H27N4O2+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-phenylmethoxy-5-piperazin-4-ium-1-yl-2-[3-[(Z)-prop-1-enyl]phenyl]pyridazin-3-one |
| SMILES | C/C=C\c1cccc(-n2ncc(N3CC[NH2+]CC3)c(OCc3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-2-7-19-10-6-11-21(16-19)28-24(29)23(30-18-20-8-4-3-5-9-20)22(17-26-28)27-14-12-25-13-15-27/h2-11,16-17,25H,12-15,18H2,1H3/p+1/b7-2- |
| InChIKey | BXAXGOCXTYKRBR-UQCOIBPSSA-O |
| XLogP | 2.23 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |