C8H13NO — CID 145478870
(3Z,5Z)-6-ethoxyhexa-1,3,5-trien-2-amine (PubChem CID 145478870) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3Z,5Z)-6-ethoxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-6-ethoxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 145478870 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3Z,5Z)-6-ethoxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C=C/OCC |
| InChI | InChI=1S/C8H13NO/c1-3-10-7-5-4-6-8(2)9/h4-7H,2-3,9H2,1H3/b6-4-,7-5- |
| InChIKey | GQMHTGTZPATWMA-PEPZGXQESA-N |
| XLogP | 1.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|