C12H17N — CID 145480072
ethane;2-methyl-6,7-dihydroquinoline (PubChem CID 145480072) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is ethane;2-methyl-6,7-dihydroquinoline.
| Compound Name | ethane;2-methyl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 145480072 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | ethane;2-methyl-6,7-dihydroquinoline |
| SMILES | CC.Cc1ccc2c(n1)=CCCC=2 |
| InChI | InChI=1S/C10H11N.C2H6/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2/h4-7H,2-3H2,1H3;1-2H3 |
| InChIKey | XLAPTUBUPGPCGW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |