C12H12F2 — CID 145480529
1-[(3E)-2,4-difluoropenta-1,3-dien-3-yl]-4-methylbenzene (PubChem CID 145480529) has the molecular formula C12H12F2 and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-[(3E)-2,4-difluoropenta-1,3-dien-3-yl]-4-methylbenzene.
| Compound Name | 1-[(3E)-2,4-difluoropenta-1,3-dien-3-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 145480529 |
| Molecular Formula | C12H12F2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[(3E)-2,4-difluoropenta-1,3-dien-3-yl]-4-methylbenzene |
| SMILES | C=C(F)/C(=C(\C)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H12F2/c1-8-4-6-11(7-5-8)12(9(2)13)10(3)14/h4-7H,2H2,1,3H3/b12-10- |
| InChIKey | XDTLNMRYCMAPLZ-BENRWUELSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|