C11H14F3N3O2S — CID 145480664
2-methyl-5-oxo-8-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide (PubChem CID 145480664) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-methyl-5-oxo-8-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide.
| Compound Name | 2-methyl-5-oxo-8-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide |
|---|---|
| PubChem CID | 145480664 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-methyl-5-oxo-8-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide |
| SMILES | CC1SCC#CC(C(F)(F)F)NCC(=O)NC1C(N)=O |
| InChI | InChI=1S/C11H14F3N3O2S/c1-6-9(10(15)19)17-8(18)5-16-7(11(12,13)14)3-2-4-20-6/h6-7,9,16H,4-5H2,1H3,(H2,15,19)(H,17,18) |
| InChIKey | IDVXQCNHTREDQZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|