C10H14F3N3OS — CID 87443675
2-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide (PubChem CID 87443675) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide.
| Compound Name | 2-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide |
|---|---|
| PubChem CID | 87443675 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(trifluoromethyl)-1-thia-4,7-diazacycloundec-9-yne-3-carboxamide |
| SMILES | NC(=O)C1NCCNCC#CCSC1C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3OS/c11-10(12,13)8-7(9(14)17)16-5-4-15-3-1-2-6-18-8/h7-8,15-16H,3-6H2,(H2,14,17) |
| InChIKey | XPGXZCLOWQLWIM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|