C29H27BrN2O2S — CID 145482438
(11E)-12-(4-bromophenyl)-N-(2-oxoazepan-3-yl)-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide (PubChem CID 145482438) has the molecular formula C29H27BrN2O2S and a molecular weight of 547.52 g/mol. Its IUPAC name is (11E)-12-(4-bromophenyl)-N-(2-oxoazepan-3-yl)-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide.
| Compound Name | (11E)-12-(4-bromophenyl)-N-(2-oxoazepan-3-yl)-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide |
|---|---|
| PubChem CID | 145482438 |
| Molecular Formula | C29H27BrN2O2S |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (11E)-12-(4-bromophenyl)-N-(2-oxoazepan-3-yl)-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)c1ccc2c(c1)CC/C=C(\c1ccc(Br)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C29H27BrN2O2S/c30-22-14-11-19(12-15-22)23-8-5-6-20-18-21(28(33)32-25-9-3-4-17-31-29(25)34)13-16-26(20)35-27-10-2-1-7-24(23)27/h1-2,7-8,10-16,18,25H,3-6,9,17H2,(H,31,34)(H,32,33)/b23-8+ |
| InChIKey | UIEOLVJZNKRUDE-LIMNOBDPSA-N |
| XLogP | 6.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |