C32H37ClN4O2S — CID 145482908
6-[(4-chlorophenyl)methylimino]-N-(2-oxoazepan-3-yl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;ethane;prop-1-ene (PubChem CID 145482908) has the molecular formula C32H37ClN4O2S and a molecular weight of 577.19 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylimino]-N-(2-oxoazepan-3-yl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;ethane;prop-1-ene.
| Compound Name | 6-[(4-chlorophenyl)methylimino]-N-(2-oxoazepan-3-yl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;ethane;prop-1-ene |
|---|---|
| PubChem CID | 145482908 |
| Molecular Formula | C32H37ClN4O2S |
| Molecular Weight | 577.19 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 6-[(4-chlorophenyl)methylimino]-N-(2-oxoazepan-3-yl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;ethane;prop-1-ene |
| SMILES | C=CC.CC.O=C(NC1CCCCNC1=O)c1ccc2c(c1)N/C(=N\Cc1ccc(Cl)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C27H25ClN4O2S.C3H6.C2H6/c28-19-11-8-17(9-12-19)16-30-25-20-5-1-2-7-23(20)35-24-13-10-18(15-22(24)31-25)26(33)32-21-6-3-4-14-29-27(21)34;1-3-2;1-2/h1-2,5,7-13,15,21H,3-4,6,14,16H2,(H,29,34)(H,30,31)(H,32,33);3H,1H2,2H3;1-2H3 |
| InChIKey | FGGAEVVNCWIBCE-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.19 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|