C22H22F3N3O2 — CID 145483152
3-(2-cyclopropylethynyl)-4-fluoro-N-methyl-N-(N'-methylcarbamimidoyl)benzamide;difluoromethoxybenzene (PubChem CID 145483152) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)-4-fluoro-N-methyl-N-(N'-methylcarbamimidoyl)benzamide;difluoromethoxybenzene.
| Compound Name | 3-(2-cyclopropylethynyl)-4-fluoro-N-methyl-N-(N'-methylcarbamimidoyl)benzamide;difluoromethoxybenzene |
|---|---|
| PubChem CID | 145483152 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-(2-cyclopropylethynyl)-4-fluoro-N-methyl-N-(N'-methylcarbamimidoyl)benzamide;difluoromethoxybenzene |
| SMILES | C/N=C(\N)N(C)C(=O)c1ccc(F)c(C#CC2CC2)c1.FC(F)Oc1ccccc1 |
| InChI | InChI=1S/C15H16FN3O.C7H6F2O/c1-18-15(17)19(2)14(20)12-7-8-13(16)11(9-12)6-5-10-3-4-10;8-7(9)10-6-4-2-1-3-5-6/h7-10H,3-4H2,1-2H3,(H2,17,18);1-5,7H |
| InChIKey | BQPMQWPRLFPYMG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|