About ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate
ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate (PubChem CID 145484562) has the molecular formula C16H23ClO4
and a molecular weight of 314.81 g/mol. Its IUPAC name is ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate.
Molecular Properties
| Compound Name | ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate |
| PubChem CID | 145484562 |
| Molecular Formula | C16H23ClO4 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate |
| SMILES | C=C(O)c1ccc(OCCCOC(=O)CCCl)cc1.CC |
| InChI | InChI=1S/C14H17ClO4.C2H6/c1-11(16)12-3-5-13(6-4-12)18-9-2-10-19-14(17)7-8-15;1-2/h3-6,16H,1-2,7-10H2;1-2H3 |
| InChIKey | OFNOABOIWMNGHB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate?
The IUPAC name of ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate (CID 145484562) is ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate.
What is the SMILES notation for ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate?
The canonical SMILES for ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate is C=C(O)c1ccc(OCCCOC(=O)CCCl)cc1.CC.
What is the InChIKey of ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate?
The InChIKey is OFNOABOIWMNGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO4.C2H6/c1-11(16)12-3-5-13(6-4-12)18-9-2-10-19-14(17)7-8-15;1-2/h3-6,16H,1-2,7-10H2;1-2H3.
What are the key properties of ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate?
ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate has a molecular weight of 314.81 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[4-(1-hydroxyethenyl)phenoxy]propyl 3-chloropropanoate is sourced from PubChem (CID 145484562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).