C20H18ClFN3O3S2- — CID 145485798
2-[2-[[5-[[2-(3-chloropropyl)-5-fluoroanilino]methyl]thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 145485798) has the molecular formula C20H18ClFN3O3S2- and a molecular weight of 466.97 g/mol. Its IUPAC name is 2-[2-[[5-[[2-(3-chloropropyl)-5-fluoroanilino]methyl]thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[[5-[[2-(3-chloropropyl)-5-fluoroanilino]methyl]thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 145485798 |
| Molecular Formula | C20H18ClFN3O3S2- |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2-[2-[[5-[[2-(3-chloropropyl)-5-fluoroanilino]methyl]thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(NC(=O)c2ccc(CNc3cc(F)ccc3CCCCl)s2)n1 |
| InChI | InChI=1S/C20H19ClFN3O3S2/c21-7-1-2-12-3-4-13(22)8-16(12)23-10-15-5-6-17(30-15)19(28)25-20-24-14(11-29-20)9-18(26)27/h3-6,8,11,23H,1-2,7,9-10H2,(H,26,27)(H,24,25,28)/p-1 |
| InChIKey | RCZWJWGXOLXUCF-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|