C22H14O2 — CID 145486098
9-ethenyl-7-methylidenepentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2(10),3,8,11,15,17-heptaene-6,14-dione (PubChem CID 145486098) has the molecular formula C22H14O2 and a molecular weight of 310.35 g/mol. Its IUPAC name is 9-ethenyl-7-methylidenepentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2(10),3,8,11,15,17-heptaene-6,14-dione.
| Compound Name | 9-ethenyl-7-methylidenepentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2(10),3,8,11,15,17-heptaene-6,14-dione |
|---|---|
| PubChem CID | 145486098 |
| Molecular Formula | C22H14O2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 9-ethenyl-7-methylidenepentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2(10),3,8,11,15,17-heptaene-6,14-dione |
| SMILES | C=Cc1c2c(cc3c1cc1c4c(cccc43)C(=O)C1)CC(=O)C2=C |
| InChI | InChI=1S/C22H14O2/c1-3-14-17-8-13-10-20(24)16-6-4-5-15(22(13)16)18(17)7-12-9-19(23)11(2)21(12)14/h3-8H,1-2,9-10H2 |
| InChIKey | FZUZAHIUJCDZOK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|