About (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane
(4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane (PubChem CID 145486977) has the molecular formula C13H22BrNO4P+
and a molecular weight of 367.20 g/mol. Its IUPAC name is (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane.
Molecular Properties
| Compound Name | (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane |
| PubChem CID | 145486977 |
| Molecular Formula | C13H22BrNO4P+ |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane |
| SMILES | CCC.COC.O=CCN[P+](=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H8BrNO3P.C3H8.C2H6O/c9-7-1-3-8(4-2-7)13-14(12)10-5-6-11;2*1-3-2/h1-4,6H,5H2,(H,10,12);3H2,1-2H3;1-2H3/q+1;; |
| InChIKey | ZXIVNLWLYJZEGL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane?
The IUPAC name of (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane (CID 145486977) is (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane.
What is the SMILES notation for (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane?
The canonical SMILES for (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane is CCC.COC.O=CCN[P+](=O)Oc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane?
The InChIKey is ZXIVNLWLYJZEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO3P.C3H8.C2H6O/c9-7-1-3-8(4-2-7)13-14(12)10-5-6-11;2*1-3-2/h1-4,6H,5H2,(H,10,12);3H2,1-2H3;1-2H3/q+1;;.
What are the key properties of (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane?
(4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane has a molecular weight of 367.20 g/mol, XLogP of 3.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenoxy)-oxo-(2-oxoethylamino)phosphanium;methoxymethane;propane is sourced from PubChem (CID 145486977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).