C16H14F3N3O3S — CID 145487173
trifluoromethylsulfonyl (Z,1Z)-3-amino-2-phenyl-N-pyridin-2-ylbut-2-enimidate (PubChem CID 145487173) has the molecular formula C16H14F3N3O3S and a molecular weight of 385.37 g/mol. Its IUPAC name is trifluoromethylsulfonyl (Z,1Z)-3-amino-2-phenyl-N-pyridin-2-ylbut-2-enimidate.
| Compound Name | trifluoromethylsulfonyl (Z,1Z)-3-amino-2-phenyl-N-pyridin-2-ylbut-2-enimidate |
|---|---|
| PubChem CID | 145487173 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | trifluoromethylsulfonyl (Z,1Z)-3-amino-2-phenyl-N-pyridin-2-ylbut-2-enimidate |
| SMILES | C/C(N)=C(C(=N/c1ccccn1)/OS(=O)(=O)C(F)(F)F)\c1ccccc1 |
| InChI | InChI=1S/C16H14F3N3O3S/c1-11(20)14(12-7-3-2-4-8-12)15(22-13-9-5-6-10-21-13)25-26(23,24)16(17,18)19/h2-10H,20H2,1H3/b14-11-,22-15- |
| InChIKey | SMMLKJGOPJGJKC-LITSVCOPSA-N |
| XLogP | 3.37 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|