C10H8F3N3O2 — CID 169213528
(2E,3Z)-2-(aminomethylidene)-4,4,4-trifluoro-3-pyridin-2-yliminobutanoic acid (PubChem CID 169213528) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is (2E,3Z)-2-(aminomethylidene)-4,4,4-trifluoro-3-pyridin-2-yliminobutanoic acid.
| Compound Name | (2E,3Z)-2-(aminomethylidene)-4,4,4-trifluoro-3-pyridin-2-yliminobutanoic acid |
|---|---|
| PubChem CID | 169213528 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2E,3Z)-2-(aminomethylidene)-4,4,4-trifluoro-3-pyridin-2-yliminobutanoic acid |
| SMILES | N/C=C(C(=O)O)\C(=N\c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O2/c11-10(12,13)8(6(5-14)9(17)18)16-7-3-1-2-4-15-7/h1-5H,14H2,(H,17,18)/b6-5+,16-8- |
| InChIKey | SFFNXAQTPDMTQC-DUCMCXKVSA-N |
| XLogP | 1.64 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|