C26H28N2O2 — CID 145488800
3-[[1-[(E)-5-anilino-2-methyl-3-methylidenepent-4-en-2-yl]naphthalen-2-yl]amino]propanoic acid (PubChem CID 145488800) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-[[1-[(E)-5-anilino-2-methyl-3-methylidenepent-4-en-2-yl]naphthalen-2-yl]amino]propanoic acid.
| Compound Name | 3-[[1-[(E)-5-anilino-2-methyl-3-methylidenepent-4-en-2-yl]naphthalen-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 145488800 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-[[1-[(E)-5-anilino-2-methyl-3-methylidenepent-4-en-2-yl]naphthalen-2-yl]amino]propanoic acid |
| SMILES | C=C(/C=C/Nc1ccccc1)C(C)(C)c1c(NCCC(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C26H28N2O2/c1-19(15-17-27-21-10-5-4-6-11-21)26(2,3)25-22-12-8-7-9-20(22)13-14-23(25)28-18-16-24(29)30/h4-15,17,27-28H,1,16,18H2,2-3H3,(H,29,30)/b17-15+ |
| InChIKey | SDRBIEKTZRXGSQ-BMRADRMJSA-N |
| XLogP | 6.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|