C30H44N4O2S — CID 145490086
3-[4-(cyclohexylmethyl)piperazin-1-yl]-1,2-benzothiazole;(4R)-4,6-diethyl-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 145490086) has the molecular formula C30H44N4O2S and a molecular weight of 524.78 g/mol. Its IUPAC name is 3-[4-(cyclohexylmethyl)piperazin-1-yl]-1,2-benzothiazole;(4R)-4,6-diethyl-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 3-[4-(cyclohexylmethyl)piperazin-1-yl]-1,2-benzothiazole;(4R)-4,6-diethyl-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 145490086 |
| Molecular Formula | C30H44N4O2S |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 3-[4-(cyclohexylmethyl)piperazin-1-yl]-1,2-benzothiazole;(4R)-4,6-diethyl-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CCC1C[C@@H](CC)C2C(=O)N(C)C(=O)C12.c1ccc2c(N3CCN(CC4CCCCC4)CC3)nsc2c1 |
| InChI | InChI=1S/C18H25N3S.C12H19NO2/c1-2-6-15(7-3-1)14-20-10-12-21(13-11-20)18-16-8-4-5-9-17(16)22-19-18;1-4-7-6-8(5-2)10-9(7)11(14)13(3)12(10)15/h4-5,8-9,15H,1-3,6-7,10-14H2;7-10H,4-6H2,1-3H3/t;7-,8?,9?,10?/m.1/s1 |
| InChIKey | DSHYNGRKVKZGHG-IWFSRJKFSA-N |
| XLogP | 5.67 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|