C30H39F3N4O2S — CID 145490102
3-[4-[[(1R)-2-methylcyclohexyl]methyl]piperazin-1-yl]-1,2-benzothiazole;(1S,6R,7S)-4-methyl-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 145490102) has the molecular formula C30H39F3N4O2S and a molecular weight of 576.73 g/mol. Its IUPAC name is 3-[4-[[(1R)-2-methylcyclohexyl]methyl]piperazin-1-yl]-1,2-benzothiazole;(1S,6R,7S)-4-methyl-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 3-[4-[[(1R)-2-methylcyclohexyl]methyl]piperazin-1-yl]-1,2-benzothiazole;(1S,6R,7S)-4-methyl-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 145490102 |
| Molecular Formula | C30H39F3N4O2S |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 3-[4-[[(1R)-2-methylcyclohexyl]methyl]piperazin-1-yl]-1,2-benzothiazole;(1S,6R,7S)-4-methyl-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC1CCCC[C@H]1CN1CCN(c2nsc3ccccc23)CC1.CN1C(=O)C2[C@@H]3CC(C(F)(F)F)[C@@H](C3)[C@H]2C1=O |
| InChI | InChI=1S/C19H27N3S.C11H12F3NO2/c1-15-6-2-3-7-16(15)14-21-10-12-22(13-11-21)19-17-8-4-5-9-18(17)23-20-19;1-15-9(16)7-4-2-5(8(7)10(15)17)6(3-4)11(12,13)14/h4-5,8-9,15-16H,2-3,6-7,10-14H2,1H3;4-8H,2-3H2,1H3/t15?,16-;4-,5+,6?,7?,8+/m00/s1 |
| InChIKey | ZBQYEZZZJBVEMX-QODTVLNYSA-N |
| XLogP | 5.68 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|