C25H31LiN4O6S2 — CID 145490778
CID 145490778 (PubChem CID 145490778) has the molecular formula C25H31LiN4O6S2 and a molecular weight of 554.62 g/mol.
| Compound Name | CID 145490778 |
|---|---|
| PubChem CID | 145490778 |
| Molecular Formula | C25H31LiN4O6S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | — |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3cc(NS(=O)(=O)C4CC4)ccc3N2)=C(O)[C@H]2[C-]1[C@@H]1CC[C@H]2C1.[Li+] |
| InChI | InChI=1S/C25H31N4O6S2.Li/c1-13(2)9-10-29-22-15-4-3-14(11-15)20(22)23(30)21(25(29)31)24-26-18-8-5-16(12-19(18)37(34,35)28-24)27-36(32,33)17-6-7-17;/h5,8,12-15,17,20,27,30H,3-4,6-7,9-11H2,1-2H3,(H,26,28);/q-1;+1/t14-,15+,20+;/m0./s1 |
| InChIKey | UZWHAKSZBFNXLQ-WCYPKXHMSA-N |
| XLogP | 0.39 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|