C40H48ClN3O4 — CID 145490937
methyl N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-8-[methyl-[4-(methylaminomethyl)-2-phenylbenzoyl]amino]octyl]carbamate (PubChem CID 145490937) has the molecular formula C40H48ClN3O4 and a molecular weight of 670.29 g/mol. Its IUPAC name is methyl N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-8-[methyl-[4-(methylaminomethyl)-2-phenylbenzoyl]amino]octyl]carbamate.
| Compound Name | methyl N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-8-[methyl-[4-(methylaminomethyl)-2-phenylbenzoyl]amino]octyl]carbamate |
|---|---|
| PubChem CID | 145490937 |
| Molecular Formula | C40H48ClN3O4 |
| Molecular Weight | 670.29 g/mol |
| Exact Mass | 669.33 |
| IUPAC Name | methyl N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-8-[methyl-[4-(methylaminomethyl)-2-phenylbenzoyl]amino]octyl]carbamate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCCN(C)C(=O)c2ccc(CNC)cc2-c2ccccc2)CCCNC(=O)OC)c1 |
| InChI | InChI=1S/C40H48ClN3O4/c1-5-29-14-11-17-32(26-29)37-35(18-12-19-36(37)41)40(47,23-13-24-43-39(46)48-4)22-9-10-25-44(3)38(45)33-21-20-30(28-42-2)27-34(33)31-15-7-6-8-16-31/h6-8,11-12,14-21,26-27,42,47H,5,9-10,13,22-25,28H2,1-4H3,(H,43,46) |
| InChIKey | AHNGAAHTNCBANJ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.29 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|