C13H19FN2O2S — CID 145491338
methyl 2-amino-3-[[3-(2-fluoroethylamino)phenyl]methylsulfanyl]propanoate (PubChem CID 145491338) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl 2-amino-3-[[3-(2-fluoroethylamino)phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl 2-amino-3-[[3-(2-fluoroethylamino)phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 145491338 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | methyl 2-amino-3-[[3-(2-fluoroethylamino)phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)C(N)CSCc1cccc(NCCF)c1 |
| InChI | InChI=1S/C13H19FN2O2S/c1-18-13(17)12(15)9-19-8-10-3-2-4-11(7-10)16-6-5-14/h2-4,7,12,16H,5-6,8-9,15H2,1H3 |
| InChIKey | PFVZHJJQAKOOOL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |