C19H14N2OY2-2 — CID 145493134
2,3-di(phenyl)-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one;bis(yttrium) (PubChem CID 145493134) has the molecular formula C19H14N2OY2-2 and a molecular weight of 464.15 g/mol. Its IUPAC name is 2,3-di(phenyl)-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one;bis(yttrium).
| Compound Name | 2,3-di(phenyl)-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one;bis(yttrium) |
|---|---|
| PubChem CID | 145493134 |
| Molecular Formula | C19H14N2OY2-2 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 463.92 |
| IUPAC Name | 2,3-di(phenyl)-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one;bis(yttrium) |
| SMILES | O=c1cccc2n1C(c1cc[c-]cc1)C(c1cc[c-]cc1)N2.[Y].[Y] |
| InChI | InChI=1S/C19H14N2O.2Y/c22-17-13-7-12-16-20-18(14-8-3-1-4-9-14)19(21(16)17)15-10-5-2-6-11-15;;/h3-13,18-20H;;/q-2;; |
| InChIKey | FVYQUFOIOYGOIY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|