C10H11N3O — CID 154150540
1,2,3,3a,4,5-hexahydroimidazo[4,5-g]quinolin-6-one (PubChem CID 154150540) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydroimidazo[4,5-g]quinolin-6-one.
| Compound Name | 1,2,3,3a,4,5-hexahydroimidazo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 154150540 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydroimidazo[4,5-g]quinolin-6-one |
| SMILES | O=c1ccc2c([nH]1)CC1NCNC1=C2 |
| InChI | InChI=1S/C10H11N3O/c14-10-2-1-6-3-8-9(12-5-11-8)4-7(6)13-10/h1-3,9,11-12H,4-5H2,(H,13,14) |
| InChIKey | KMEKZCYRZYPWHZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |