C43H71F3O8S — CID 145493683
2-(2-tert-butyl-2,4-dimethylpentanoyl)oxyethanesulfonic acid;4,4-dimethyl-2-propan-2-yl-2-(trifluoromethyl)pentanoic acid;6-(2,5,5-trimethylhexan-3-yl)naphthalen-2-ol (PubChem CID 145493683) has the molecular formula C43H71F3O8S and a molecular weight of 805.09 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4-dimethylpentanoyl)oxyethanesulfonic acid;4,4-dimethyl-2-propan-2-yl-2-(trifluoromethyl)pentanoic acid;6-(2,5,5-trimethylhexan-3-yl)naphthalen-2-ol.
| Compound Name | 2-(2-tert-butyl-2,4-dimethylpentanoyl)oxyethanesulfonic acid;4,4-dimethyl-2-propan-2-yl-2-(trifluoromethyl)pentanoic acid;6-(2,5,5-trimethylhexan-3-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 145493683 |
| Molecular Formula | C43H71F3O8S |
| Molecular Weight | 805.09 g/mol |
| Exact Mass | 804.48 |
| IUPAC Name | 2-(2-tert-butyl-2,4-dimethylpentanoyl)oxyethanesulfonic acid;4,4-dimethyl-2-propan-2-yl-2-(trifluoromethyl)pentanoic acid;6-(2,5,5-trimethylhexan-3-yl)naphthalen-2-ol |
| SMILES | CC(C)C(CC(C)(C)C)(C(=O)O)C(F)(F)F.CC(C)C(CC(C)(C)C)c1ccc2cc(O)ccc2c1.CC(C)CC(C)(C(=O)OCCS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H26O.C13H26O5S.C11H19F3O2/c1-13(2)18(12-19(3,4)5)16-7-6-15-11-17(20)9-8-14(15)10-16;1-10(2)9-13(6,12(3,4)5)11(14)18-7-8-19(15,16)17;1-7(2)10(8(15)16,11(12,13)14)6-9(3,4)5/h6-11,13,18,20H,12H2,1-5H3;10H,7-9H2,1-6H3,(H,15,16,17);7H,6H2,1-5H3,(H,15,16) |
| InChIKey | XCEWDVZXLIUENU-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.09 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|