C30H41ClN3O4Y- — CID 145496273
6-chloro-1-[4-(6-pyrrolidin-1-ylhexoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide;1-hydroperoxy-2-methoxyethane;yttrium (PubChem CID 145496273) has the molecular formula C30H41ClN3O4Y- and a molecular weight of 632.03 g/mol. Its IUPAC name is 6-chloro-1-[4-(6-pyrrolidin-1-ylhexoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide;1-hydroperoxy-2-methoxyethane;yttrium.
| Compound Name | 6-chloro-1-[4-(6-pyrrolidin-1-ylhexoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide;1-hydroperoxy-2-methoxyethane;yttrium |
|---|---|
| PubChem CID | 145496273 |
| Molecular Formula | C30H41ClN3O4Y- |
| Molecular Weight | 632.03 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | 6-chloro-1-[4-(6-pyrrolidin-1-ylhexoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide;1-hydroperoxy-2-methoxyethane;yttrium |
| SMILES | COCCOO.Clc1ccc2[nH]c3c(c2c1)CC[N-]C3c1ccc(OCCCCCCN2CCCC2)cc1.[Y] |
| InChI | InChI=1S/C27H33ClN3O.C3H8O3.Y/c28-21-9-12-25-24(19-21)23-13-14-29-26(27(23)30-25)20-7-10-22(11-8-20)32-18-6-2-1-3-15-31-16-4-5-17-31;1-5-2-3-6-4;/h7-12,19,26,30H,1-6,13-18H2;4H,2-3H2,1H3;/q-1;; |
| InChIKey | MTAOREBFIBGESH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|