C26H31ClN5O4Y- — CID 145496040
1-[amino-[(Z)-2-aminoethenyl]amino]-3-[4-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-id-1-yl)phenoxy]propan-2-ol;1-hydroperoxybut-2-yne;yttrium (PubChem CID 145496040) has the molecular formula C26H31ClN5O4Y- and a molecular weight of 601.92 g/mol. Its IUPAC name is 1-[amino-[(Z)-2-aminoethenyl]amino]-3-[4-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-id-1-yl)phenoxy]propan-2-ol;1-hydroperoxybut-2-yne;yttrium.
| Compound Name | 1-[amino-[(Z)-2-aminoethenyl]amino]-3-[4-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-id-1-yl)phenoxy]propan-2-ol;1-hydroperoxybut-2-yne;yttrium |
|---|---|
| PubChem CID | 145496040 |
| Molecular Formula | C26H31ClN5O4Y- |
| Molecular Weight | 601.92 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | 1-[amino-[(Z)-2-aminoethenyl]amino]-3-[4-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-id-1-yl)phenoxy]propan-2-ol;1-hydroperoxybut-2-yne;yttrium |
| SMILES | CC#CCOO.N/C=C\N(N)CC(O)COc1ccc(C2[N-]CCc3c2[nH]c2ccc(Cl)cc32)cc1.[Y] |
| InChI | InChI=1S/C22H25ClN5O2.C4H6O2.Y/c23-15-3-6-20-19(11-15)18-7-9-26-21(22(18)27-20)14-1-4-17(5-2-14)30-13-16(29)12-28(25)10-8-24;1-2-3-4-6-5;/h1-6,8,10-11,16,21,27,29H,7,9,12-13,24-25H2;5H,4H2,1H3;/q-1;;/b10-8-;; |
| InChIKey | NJEGOEYCHQYYGI-GPWRMYTLSA-N |
| XLogP | 3.68 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|