About 1-cyclobutylpiperidine;4-methylbenzenethiol
1-cyclobutylpiperidine;4-methylbenzenethiol (PubChem CID 145497273) has the molecular formula C16H25NS
and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-cyclobutylpiperidine;4-methylbenzenethiol.
Molecular Properties
| Compound Name | 1-cyclobutylpiperidine;4-methylbenzenethiol |
| PubChem CID | 145497273 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-cyclobutylpiperidine;4-methylbenzenethiol |
| SMILES | C1CCN(C2CCC2)CC1.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C9H17N.C7H8S/c1-2-7-10(8-3-1)9-5-4-6-9;1-6-2-4-7(8)5-3-6/h9H,1-8H2;2-5,8H,1H3 |
| InChIKey | BDUHHALQCKVPHN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutylpiperidine;4-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutylpiperidine;4-methylbenzenethiol?
The IUPAC name of 1-cyclobutylpiperidine;4-methylbenzenethiol (CID 145497273) is 1-cyclobutylpiperidine;4-methylbenzenethiol.
What is the SMILES notation for 1-cyclobutylpiperidine;4-methylbenzenethiol?
The canonical SMILES for 1-cyclobutylpiperidine;4-methylbenzenethiol is C1CCN(C2CCC2)CC1.Cc1ccc(S)cc1.
What is the InChIKey of 1-cyclobutylpiperidine;4-methylbenzenethiol?
The InChIKey is BDUHHALQCKVPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C7H8S/c1-2-7-10(8-3-1)9-5-4-6-9;1-6-2-4-7(8)5-3-6/h9H,1-8H2;2-5,8H,1H3.
What are the key properties of 1-cyclobutylpiperidine;4-methylbenzenethiol?
1-cyclobutylpiperidine;4-methylbenzenethiol has a molecular weight of 263.45 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutylpiperidine;4-methylbenzenethiol is sourced from PubChem (CID 145497273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).