C23H28N4OS — CID 145497735
N-[3-[(tert-butylamino)sulfanylmethyl]phenyl]-6-(2-ethoxyphenyl)pyrimidin-4-amine (PubChem CID 145497735) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[3-[(tert-butylamino)sulfanylmethyl]phenyl]-6-(2-ethoxyphenyl)pyrimidin-4-amine.
| Compound Name | N-[3-[(tert-butylamino)sulfanylmethyl]phenyl]-6-(2-ethoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 145497735 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[3-[(tert-butylamino)sulfanylmethyl]phenyl]-6-(2-ethoxyphenyl)pyrimidin-4-amine |
| SMILES | CCOc1ccccc1-c1cc(Nc2cccc(CSNC(C)(C)C)c2)ncn1 |
| InChI | InChI=1S/C23H28N4OS/c1-5-28-21-12-7-6-11-19(21)20-14-22(25-16-24-20)26-18-10-8-9-17(13-18)15-29-27-23(2,3)4/h6-14,16,27H,5,15H2,1-4H3,(H,24,25,26) |
| InChIKey | BVCISQDFORNZON-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|