C22H24N4O3S — CID 145497885
[3-[[6-[2-(oxolan-2-ylmethoxy)phenyl]pyrimidin-4-yl]amino]phenyl]methanesulfinamide (PubChem CID 145497885) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is [3-[[6-[2-(oxolan-2-ylmethoxy)phenyl]pyrimidin-4-yl]amino]phenyl]methanesulfinamide.
| Compound Name | [3-[[6-[2-(oxolan-2-ylmethoxy)phenyl]pyrimidin-4-yl]amino]phenyl]methanesulfinamide |
|---|---|
| PubChem CID | 145497885 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [3-[[6-[2-(oxolan-2-ylmethoxy)phenyl]pyrimidin-4-yl]amino]phenyl]methanesulfinamide |
| SMILES | NS(=O)Cc1cccc(Nc2cc(-c3ccccc3OCC3CCCO3)ncn2)c1 |
| InChI | InChI=1S/C22H24N4O3S/c23-30(27)14-16-5-3-6-17(11-16)26-22-12-20(24-15-25-22)19-8-1-2-9-21(19)29-13-18-7-4-10-28-18/h1-3,5-6,8-9,11-12,15,18H,4,7,10,13-14,23H2,(H,24,25,26) |
| InChIKey | XGVMSLOSZPMPNL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |