C15H17NO4 — CID 54847413
[5-[2-(oxolan-2-ylmethoxy)phenyl]-1,2-oxazol-3-yl]methanol (PubChem CID 54847413) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is [5-[2-(oxolan-2-ylmethoxy)phenyl]-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-[2-(oxolan-2-ylmethoxy)phenyl]-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 54847413 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [5-[2-(oxolan-2-ylmethoxy)phenyl]-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(-c2ccccc2OCC2CCCO2)on1 |
| InChI | InChI=1S/C15H17NO4/c17-9-11-8-15(20-16-11)13-5-1-2-6-14(13)19-10-12-4-3-7-18-12/h1-2,5-6,8,12,17H,3-4,7,9-10H2 |
| InChIKey | XXUVVTBCPTXBRK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |