C8H17N3 — CID 145498022
5-(aminomethyl)-1,2-dihydropyridin-6-amine;ethane (PubChem CID 145498022) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 5-(aminomethyl)-1,2-dihydropyridin-6-amine;ethane.
| Compound Name | 5-(aminomethyl)-1,2-dihydropyridin-6-amine;ethane |
|---|---|
| PubChem CID | 145498022 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 5-(aminomethyl)-1,2-dihydropyridin-6-amine;ethane |
| SMILES | CC.NCC1=C(N)NCC=C1 |
| InChI | InChI=1S/C6H11N3.C2H6/c7-4-5-2-1-3-9-6(5)8;1-2/h1-2,9H,3-4,7-8H2;1-2H3 |
| InChIKey | XSXOWFGFZWHQAR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |