C18H27NO4 — CID 1455084
[2-(cyclohexylamino)-2-oxoethyl] 5-tert-butyl-3-methylfuran-2-carboxylate (PubChem CID 1455084) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 5-tert-butyl-3-methylfuran-2-carboxylate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 5-tert-butyl-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 1455084 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 5-tert-butyl-3-methylfuran-2-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)oc1C(=O)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H27NO4/c1-12-10-14(18(2,3)4)23-16(12)17(21)22-11-15(20)19-13-8-6-5-7-9-13/h10,13H,5-9,11H2,1-4H3,(H,19,20) |
| InChIKey | BHRADGWITKMVJU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |