About methyl 5-acetyloxyheptanoate
methyl 5-acetyloxyheptanoate (PubChem CID 14561756) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 5-acetyloxyheptanoate.
Molecular Properties
| Compound Name | methyl 5-acetyloxyheptanoate |
| PubChem CID | 14561756 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl 5-acetyloxyheptanoate |
| SMILES | CCC(CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C10H18O4/c1-4-9(14-8(2)11)6-5-7-10(12)13-3/h9H,4-7H2,1-3H3 |
| InChIKey | AJESJKFEDDPITP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-acetyloxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyloxyheptanoate?
The IUPAC name of methyl 5-acetyloxyheptanoate (CID 14561756) is methyl 5-acetyloxyheptanoate.
What is the SMILES notation for methyl 5-acetyloxyheptanoate?
The canonical SMILES for methyl 5-acetyloxyheptanoate is CCC(CCCC(=O)OC)OC(C)=O.
What is the InChIKey of methyl 5-acetyloxyheptanoate?
The InChIKey is AJESJKFEDDPITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-4-9(14-8(2)11)6-5-7-10(12)13-3/h9H,4-7H2,1-3H3.
What are the key properties of methyl 5-acetyloxyheptanoate?
methyl 5-acetyloxyheptanoate has a molecular weight of 202.25 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyloxyheptanoate is sourced from PubChem (CID 14561756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).