C14H22O2Si — CID 14565406
[(E)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 14565406) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is [(E)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(E)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 14565406 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [(E)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | CCOC(C#C/C=C/C#C[Si](C)(C)C)OCC |
| InChI | InChI=1S/C14H22O2Si/c1-6-15-14(16-7-2)12-10-8-9-11-13-17(3,4)5/h8-9,14H,6-7H2,1-5H3/b9-8+ |
| InChIKey | BPOQXQBNXSSHBD-CMDGGOBGSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|