C13H24O2Si — CID 15207683
[(E)-6,6-diethoxyhex-2-en-4-ynyl]-trimethylsilane (PubChem CID 15207683) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is [(E)-6,6-diethoxyhex-2-en-4-ynyl]-trimethylsilane.
| Compound Name | [(E)-6,6-diethoxyhex-2-en-4-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 15207683 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(E)-6,6-diethoxyhex-2-en-4-ynyl]-trimethylsilane |
| SMILES | CCOC(C#C/C=C/C[Si](C)(C)C)OCC |
| InChI | InChI=1S/C13H24O2Si/c1-6-14-13(15-7-2)11-9-8-10-12-16(3,4)5/h8,10,13H,6-7,12H2,1-5H3/b10-8+ |
| InChIKey | JTNTYONEMMJFEN-CSKARUKUSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|