C20H32Br2O3 — CID 14565458
1-bromo-8a-(bromomethyl)-4,10a-dimethyl-8-propan-2-yl-2,3,4a,6,7,8,9,10-octahydro-1H-phenanthrene-3,4,6-triol (PubChem CID 14565458) has the molecular formula C20H32Br2O3 and a molecular weight of 480.28 g/mol. Its IUPAC name is 1-bromo-8a-(bromomethyl)-4,10a-dimethyl-8-propan-2-yl-2,3,4a,6,7,8,9,10-octahydro-1H-phenanthrene-3,4,6-triol.
| Compound Name | 1-bromo-8a-(bromomethyl)-4,10a-dimethyl-8-propan-2-yl-2,3,4a,6,7,8,9,10-octahydro-1H-phenanthrene-3,4,6-triol |
|---|---|
| PubChem CID | 14565458 |
| Molecular Formula | C20H32Br2O3 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-bromo-8a-(bromomethyl)-4,10a-dimethyl-8-propan-2-yl-2,3,4a,6,7,8,9,10-octahydro-1H-phenanthrene-3,4,6-triol |
| SMILES | CC(C)C1CC(O)C=C2C3C(C)(O)C(O)CC(Br)C3(C)CCC21CBr |
| InChI | InChI=1S/C20H32Br2O3/c1-11(2)13-7-12(23)8-14-17-18(3,5-6-20(13,14)10-21)15(22)9-16(24)19(17,4)25/h8,11-13,15-17,23-25H,5-7,9-10H2,1-4H3 |
| InChIKey | GYAWJQDSSUBDTF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|