C10H14F3N3O2 — CID 14578078
1-butyl-1-methyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea (PubChem CID 14578078) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is 1-butyl-1-methyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea.
| Compound Name | 1-butyl-1-methyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
|---|---|
| PubChem CID | 14578078 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-butyl-1-methyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
| SMILES | CCCCN(C)C(=O)Nc1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C10H14F3N3O2/c1-3-4-5-16(2)9(17)14-8-6-7(15-18-8)10(11,12)13/h6H,3-5H2,1-2H3,(H,14,17) |
| InChIKey | ZOZMKGPEEBWPDD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |