C7H11ClF3O3PS — CID 14579046
2-chloro-3-[ethoxy(methylsulfanyl)phosphoryl]oxy-1,1,2-trifluorocyclobutane (PubChem CID 14579046) has the molecular formula C7H11ClF3O3PS and a molecular weight of 298.65 g/mol. Its IUPAC name is 2-chloro-3-[ethoxy(methylsulfanyl)phosphoryl]oxy-1,1,2-trifluorocyclobutane.
| Compound Name | 2-chloro-3-[ethoxy(methylsulfanyl)phosphoryl]oxy-1,1,2-trifluorocyclobutane |
|---|---|
| PubChem CID | 14579046 |
| Molecular Formula | C7H11ClF3O3PS |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-chloro-3-[ethoxy(methylsulfanyl)phosphoryl]oxy-1,1,2-trifluorocyclobutane |
| SMILES | CCOP(=O)(OC1CC(F)(F)C1(F)Cl)SC |
| InChI | InChI=1S/C7H11ClF3O3PS/c1-3-13-15(12,16-2)14-5-4-6(9,10)7(5,8)11/h5H,3-4H2,1-2H3 |
| InChIKey | PKJNSDNAMYEJEC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|