C8H8ClF7 — CID 556598
2-chloro-1,1,2-trifluoro-3-(1,1,2,2-tetrafluorobutyl)cyclobutane (PubChem CID 556598) has the molecular formula C8H8ClF7 and a molecular weight of 272.59 g/mol. Its IUPAC name is 2-chloro-1,1,2-trifluoro-3-(1,1,2,2-tetrafluorobutyl)cyclobutane.
| Compound Name | 2-chloro-1,1,2-trifluoro-3-(1,1,2,2-tetrafluorobutyl)cyclobutane |
|---|---|
| PubChem CID | 556598 |
| Molecular Formula | C8H8ClF7 |
| Molecular Weight | 272.59 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-chloro-1,1,2-trifluoro-3-(1,1,2,2-tetrafluorobutyl)cyclobutane |
| SMILES | CCC(F)(F)C(F)(F)C1CC(F)(F)C1(F)Cl |
| InChI | InChI=1S/C8H8ClF7/c1-2-5(10,11)8(15,16)4-3-6(12,13)7(4,9)14/h4H,2-3H2,1H3 |
| InChIKey | RCRCXZOKWCKQNG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|