C10H6F12 — CID 548581
1,1,2,2-tetrafluoro-3-[1,1,2,2-tetrafluoro-2-(2,2,3,3-tetrafluorocyclobutyl)ethyl]cyclobutane (PubChem CID 548581) has the molecular formula C10H6F12 and a molecular weight of 354.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-[1,1,2,2-tetrafluoro-2-(2,2,3,3-tetrafluorocyclobutyl)ethyl]cyclobutane.
| Compound Name | 1,1,2,2-tetrafluoro-3-[1,1,2,2-tetrafluoro-2-(2,2,3,3-tetrafluorocyclobutyl)ethyl]cyclobutane |
|---|---|
| PubChem CID | 548581 |
| Molecular Formula | C10H6F12 |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-[1,1,2,2-tetrafluoro-2-(2,2,3,3-tetrafluorocyclobutyl)ethyl]cyclobutane |
| SMILES | FC1(F)CC(C(F)(F)C(F)(F)C2CC(F)(F)C2(F)F)C1(F)F |
| InChI | InChI=1S/C10H6F12/c11-5(12)1-3(7(5,15)16)9(19,20)10(21,22)4-2-6(13,14)8(4,17)18/h3-4H,1-2H2 |
| InChIKey | KZMBHPBDAKDTAV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|