C8H6F8 — CID 555505
1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluorobut-3-enyl)cyclobutane (PubChem CID 555505) has the molecular formula C8H6F8 and a molecular weight of 254.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluorobut-3-enyl)cyclobutane.
| Compound Name | 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluorobut-3-enyl)cyclobutane |
|---|---|
| PubChem CID | 555505 |
| Molecular Formula | C8H6F8 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluorobut-3-enyl)cyclobutane |
| SMILES | C=CC(F)(F)C(F)(F)C1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H6F8/c1-2-5(9,10)7(13,14)4-3-6(11,12)8(4,15)16/h2,4H,1,3H2 |
| InChIKey | AFUDIAPLAMRHQB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|