C16H15F19O — CID 157326079
2,2,3,3,4,4,5,5,6,6-decafluorooxonane;1,1,1,2,2,4,4,6,6-nonafluorooctane (PubChem CID 157326079) has the molecular formula C16H15F19O and a molecular weight of 584.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluorooxonane;1,1,1,2,2,4,4,6,6-nonafluorooctane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluorooxonane;1,1,1,2,2,4,4,6,6-nonafluorooctane |
|---|---|
| PubChem CID | 157326079 |
| Molecular Formula | C16H15F19O |
| Molecular Weight | 584.26 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluorooxonane;1,1,1,2,2,4,4,6,6-nonafluorooctane |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)C(F)(F)F.FC1(F)CCCOC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H6F10O.C8H9F9/c9-4(10)2-1-3-19-8(17,18)7(15,16)6(13,14)5(4,11)12;1-2-5(9,10)3-6(11,12)4-7(13,14)8(15,16)17/h1-3H2;2-4H2,1H3 |
| InChIKey | BESRVASNJABMJC-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.26 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|