C46H50O8S — CID 14587950
(2R,3S,4S)-5-(benzenesulfinyl)-6-[(1R)-2,2-diethoxy-1-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran (PubChem CID 14587950) has the molecular formula C46H50O8S and a molecular weight of 762.97 g/mol. Its IUPAC name is (2R,3S,4S)-5-(benzenesulfinyl)-6-[(1R)-2,2-diethoxy-1-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3S,4S)-5-(benzenesulfinyl)-6-[(1R)-2,2-diethoxy-1-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 14587950 |
| Molecular Formula | C46H50O8S |
| Molecular Weight | 762.97 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | (2R,3S,4S)-5-(benzenesulfinyl)-6-[(1R)-2,2-diethoxy-1-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
| SMILES | CCOC(OCC)[C@H](OCc1ccccc1)C1=C(S(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C46H50O8S/c1-3-49-46(50-4-2)44(53-33-38-26-16-8-17-27-38)43-45(55(47)39-28-18-9-19-29-39)42(52-32-37-24-14-7-15-25-37)41(51-31-36-22-12-6-13-23-36)40(54-43)34-48-30-35-20-10-5-11-21-35/h5-29,40-42,44,46H,3-4,30-34H2,1-2H3/t40-,41+,42+,44-,55?/m1/s1 |
| InChIKey | IIMMLYBDCKEOHN-BOAGJKCOSA-N |
| XLogP | 8.78 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.97 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|