C21H24FN3OS — CID 14592307
3'-cyclohexyl-5-fluoro-2'-sulfanylidenespiro[1H-indole-3,4'-5,6,7,8-tetrahydro-4aH-quinazoline]-2-one (PubChem CID 14592307) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is 3'-cyclohexyl-5-fluoro-2'-sulfanylidenespiro[1H-indole-3,4'-5,6,7,8-tetrahydro-4aH-quinazoline]-2-one.
| Compound Name | 3'-cyclohexyl-5-fluoro-2'-sulfanylidenespiro[1H-indole-3,4'-5,6,7,8-tetrahydro-4aH-quinazoline]-2-one |
|---|---|
| PubChem CID | 14592307 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3'-cyclohexyl-5-fluoro-2'-sulfanylidenespiro[1H-indole-3,4'-5,6,7,8-tetrahydro-4aH-quinazoline]-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C12C1CCCCC1=NC(=S)N2C1CCCCC1 |
| InChI | InChI=1S/C21H24FN3OS/c22-13-10-11-18-16(12-13)21(19(26)23-18)15-8-4-5-9-17(15)24-20(27)25(21)14-6-2-1-3-7-14/h10-12,14-15H,1-9H2,(H,23,26) |
| InChIKey | HCOQZLZDLWMFDX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|